62 Answered Questions for the topic Equilibrium

Equilibrium Chemistry Catalyst

11/24/18

Are the following aspects of a catalyzed reaction different from the uncatalyzed reaction?

Are these aspects different in a catalyzed reaction?1. The mechanism2. ΔE rxn3. The overall equation
Equilibrium

11/02/18

Equilibrium question

Consider the reaction N2O4 (g)---------2NO2 (g).(reversible). If 0.2 is the degree of disassociation , starting with 2.0 moles of N2O4 , the total number of moles at equilibrium would be?
Equilibrium

11/02/18

Equilibrium question

Te disassociation equilibrium of a gas AB2 can be represented as: 2AB2(g)---------2AB(g) + B2(g) . The degree of disassociation is 'x' and is small compared to 1. The expression relating the degree... more
Equilibrium

10/06/18

how is Fe{3+} affected when you ADD HPO4{2+}?

Solution: Fe{3+}(aq) + SCN{-}(aq) —> Fe(SCN){2+}(aq)I know that the color gets clear when you add HPO4{2+}, but I don’t know why.
Equilibrium Chemistry Solubility

09/11/18

What is the maximum concentration of silver ions that can be present in a 2.0 x 10^-3 M sodium chloride solution?

How would this question be approached? 
Equilibrium Chemistry

07/22/18

Hb(aq) + O 2(g) ↔ HbO 2(aq)

I am asked to write an equilibrium expression, and to include the term pO2 for the oxygen gas term. 
Equilibrium

01/23/18

Calculating constant equilibrium

how do you calculate the constant equilibrium if what's known is ONLY the initial concentration of cC and dD aka the products.    Using the ice table how do you determine what the Keq if the... more
Equilibrium Chemistry

01/07/18

equilibrium shift using haber process

Using the Haber process (produces NH3 from Nitrogen and hydrogen gas) give 2 situations which would shift the equilibrium to the right and give 2 examples/situations which would shift the... more
Equilibrium Enzyme Kinetics

12/29/17

Why is the Kd equation Kd=Koff/Kon instead of K=Kon/Koff?

Lets say a general equation for enzymes is E+S<-->ES<-->E+P, and an expression for the Kd of the enzyme is Kd=[E]+[S]/[ES]. Most K expressions are [Products]/[Reactants], right? In the... more
Equilibrium

10/30/17

Can an irreversible reaction be a reversible reaction

Can a reversible reaction be an irreversible reaction and an irreversible reaction be a reversible reaction
Equilibrium

01/23/17

the demand function for a firm is given as P=60-0.5p and the supply function is p= 10+Q

1. find the equilibrium price and quantity. 2.calculate the consumer surplus and producer surplus at equlibrium
Equilibrium

12/28/16

I have doubt in derivation of the relation between Ka and Kb in ionic equilibrium topic

While deriving the relation between Ka and Kb in ionic equilibrium topic, say I take an example of NH4+ + H2O ----> NH3 + H3O+ ......(1)Ka of this reaction is : [NH3][H3O+]/[NH4+][H2O]Now NH3 is... more
Equilibrium Chemistry

11/08/16

CHEMICAL EQUILIBRIUM DOUBTS

4 moles of PCl5 are heated in a closed container of 4 dm3 container at 400 k. At equilibrium, 50% of PCl5 is dissociated. What is the value of Kc for the dissociation of PCl5 into PCl3 and Cl2 at... more

equilibrium of turning moments

https://postimg.org/image/m5vobypg3/

09/22/16

Why doesn't NaCl and HCl have the same effect on an equilibrium reaction

Recently in my AP Chem class we did a simple reaction demonstrating equilibrium: [Co(H2O)6]2+(aq)(pink) + 4Cl-(aq) <--> [CoCl4]2-(aq)(blue) + 6H2O(l) (in an ethanol solution). The reaction... more
Equilibrium Chemistry Constant

04/10/16

How do I calculate the equilibrium constant from Delta G?

Carbon disulfide is a foul-smelling solvent that dissolves sulfur and other nonpolar substances. It can be made be made by heating sulfur in an atmosphere of methane.For the reaction below, Delta... more

03/16/16

How do I work out the molarity and equilibrium constant using moles of reactants?

The equation is C2H5OH(aq) + CH3CO2H(aq) ? CH3CO2C2H5(aq) + H2O(l)   Moles of ethanol: 0.0747 Moles of ethanoic acid: 0.0112   amount of ethanol used in experiment: 4cm3 amount of ethanoic... more

CHEM 2 Solubility Equilibrium Question?? PLEASE HELP!?

Hi everyone. I have two questions that I think I found the answer to, but could you check and see if they are right? If they are incorrect, could you show me how you achieved the correct answer?... more

Equilibrium Constant

The basic question I am asking is how does varying the initial concentrations of reactant(s) in a chemical reaction affect the equilibrium constant. What I have so far is:   Using this basic... more

02/17/16

Chemistry Equilibrium Problem? Calculate the partial pressure of a reactant? PLEASE HELP!??

I am really stuck since I am new to equilibrium and would love if someone could show me how to solve this so I can learn!   For the reaction 4KO2(s) + 2H2O(g) ↔ 4KOH(s) + 3O2(g), an equilibrium... more

Find the equilibrium concentration of hydrogen? PLEASE HELP and CHECK MY ANSWER?

The reaction N2 + 3H2 ↔ 2NH3 at equilibrium was found to contain 1.00 M of nitrogen and 0.500 M of ammonia. Calculate the equilibrium concentration of hydrogen if Kc = 0.988.I really want to make... more
Equilibrium

09/23/15

A local movie theatre has introduced a deal on popcorn every Tuesday. The theatre has also recently switched to a cheaper fountain drink syrup. How do these cha

A local movie theatre has introduced a deal on popcorn every Tuesday. The theatre hasalso recently switched to a cheaper fountain drink syrup. How do these changes impactthe equilibrium price and... more
Equilibrium

09/23/15

How would the equilibrium price and quantity for TV dinners change if the average annual income in Canada increases? Explain your answer using a graph.

How would the equilibrium price and quantity for TV dinners change if the averageannual income in Canada increases? Explain your answer using a graph.

Still looking for help? Get the right answer, fast.

Ask a question for free

Get a free answer to a quick problem.
Most questions answered within 4 hours.

OR

Find an Online Tutor Now

Choose an expert and meet online. No packages or subscriptions, pay only for the time you need.