J.R. S.

02/16/18

what is the identity of the gas that is produced

add 5 ml of hydrochloric acid to a test tube drop 3 small pieces of zinc into the test tube loosely cover the test tube with a cork to trap the gas that is evolved

Follows • 2

Answers •1

Other

02/15/18

We start with 153 grams of NH3, and 416 grams of O2. What is the limiting reactant?

4NH3+5O2=4NO+6H2O

Follows • 2

Answers •1

Other

02/15/18

What is the limiting reactant if we start with 158 mol C2H5OH, and 460 mol O2?

C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l)

Follows • 2

Answers •1

Weight

02/15/18

Im trying to figure out the weight of something from kg/meter and need to put it into lb/ft.

The product weighs 0.5kg/m and the overall length is 4.57 meters. I need to put that into lbs/ft. Does that make sense??

Follows • 2

Answers •1

Chemistry

02/15/18

partial OXIDATION OF HYDROCARBONS IN NATURAL GAS

I am designing a reactor for POX of natural gas. 90% is methane and remainder consists of ethane, propane, butane. reactor temp is 1473 K, methane is partially and fully oxidised. how will other... more

Follows • 2

Answers •1

Chemistry

02/14/18

How does the carboxly group bond and why do they bond

Having trouble with this question for a while how do they bond such as "why does bond with carbon with a double bond"

Follows • 2

Answers •1

Chemistry Moles

02/14/18

Calculate the smallest whole number ration of moles of water to moles of anhydrous salt.

H2O: 1.53g = 8.5 x 10-2 moles CuSo4 : 0.87g = 5.5 x 10-3 moles

Follows • 2

Answers •1

Lme Class Info

02/14/18

Simple carbohydrates consist of sugar

I want to know this for an LME class test imma have so help me

Follows • 2

Answers •1

#watergas #hydrogen

02/14/18

How many atoms of hydrogen is there in 2,24 litres of water gas

Water gas is a mixture of carbon monoxide and hydrogen produced from synthesis gas

Follows • 2

Answers •1

Chemistry

02/14/18

Assume that the air used to pressurize the chamber is 21 percent O2 by volume.

What chamber pressure would be required for a patient to receive the therapeutic partial pressure of O2 (2.8 atm) without breathing a special mixture of gases through a mask? Assume that the air... more

Follows • 2

Answers •2

#math#help#please

02/14/18

What is 3k-2=10 what does k =

I need help with my math please!!

Follows • 2

Answers •1

Science

02/14/18

A can of juice at 20°C is completely submerged in a closed, insulated container filled with water at 4°C, as shown in the diagram.

A can of juice at 20°C is completely submerged in a closed, insulated container filled with water at 4°C, as shown in the diagram. A.Describe what happens to the temperature of the can of juice and... more

Follows • 3

Answers •2

Mathematics

02/14/18

Write the following rate as a unit rate. On average in a recent year, it cost each passenger about $597 to travel 5970 miles internationally by plane.

Write the following rate as a unit rate.On average in a recent year, it cost each passenger about $597 to travel 5970 miles internationally by plane.

Follows • 2

Answers •1

Molar Mass

02/14/18

how to find molar mass of an unknown compound

A solution is prepared with 3.85 g of an unknown compound in 100.0 g of cyclohexane. The solution had a freezing point of 4.18 degrees Celsius. what is the molar mass of the unknown compound?

Follows • 2

Answers •1

Chemistry

02/13/18

Chemistry size of elements

The size of boron is _____ than that of oxygen and _________ than that of aluminum -smaller;larger -larger;smaller -smaller;smaller -larger;larger

Follows • 2

Answers •1

Chemistry Vapour Pressure

02/13/18

vapor pressure of solution 13.00 g of CaCl2 in 115.0 g of H2O at 70 ∘C, van't Hoff factor of 2.7? The vapor pressure of pure water at 70 ∘C is 233.7 mmHg.

What is the vapor pressure in mmHg of a solution made by dissolving 13.00 g of CaCl2 in 115.0 g of H2O at 70 ∘C, assuming a van't Hoff factor of 2.7? The vapor pressure of pure water at 70 ∘C is... more

Follows • 2

Answers •1

Entropy

02/13/18

Calculate the change in free energy for 4NH3 +7O2 yields 4NO2 +6H2O

How do we work this problem?

Follows • 2

Answers •1

Environmental Science

02/13/18

How many degrees Celcius can 1 gram of water be heated by 0.26 Calories (kcal)

I would like to know how many degrred celsius can 1 gram of water be heated by .26 Calories

Follows • 2

Answers •1

Fire And Smoke

02/13/18

Why does a fire(with flames)produce smoke?

None to be added,Question asked by Ashley Martin,Hampshire,England.

Follows • 2

Answers •1

Biology Biology,dilution Calculation Dilution Calculations

02/13/18

how to perform 1: 5 x 10^ 3 dilution ?

For determination of the number of yeast cells in suspension a counting chamber is used.However, the yeast suspension contains too many cells for direct counting. Hence a 1: 5 x 10^3dilution is... more

Follows • 2

Answers •1

Other

02/13/18

The half-life for the radioactive decay of calcium-47 is 4.5 d. If a sample has an activity of 4.0 Ci after 18 d , what was the initial activity of the sample?

2 sig figs

Follows • 2

Answers •1

Chemistry

02/12/18

Chemistry trend in ionization

what is the trend in ionization energy in the series of group IIA elements Be through Ra? ionization energy creases at first and then decreases in this series? Ionization energy decreases... more

Follows • 2

Answers •1

Chemistry

02/12/18

Chemistry VIIIA group

Group VIIIA elements are also called: noble gases, alkaline earth metals, alkali metals or halogens?

Follows • 2

Answers •1

Chemistry

02/12/18

Chemistry: What is the mass of the matter inside a container

Suppose 27.5g of sodium is reacted with 100.0g of chlorine in a sealed container to yield 70.0g of the compound NaCl. In the process, all of the sodium is consumed, but some of the chlorine is left... more

Follows • 2

Answers •1

Chemistry Filtration

02/12/18

why do we filter a solution, before distilling it?

Why do we filter a solution before distilling it?

Follows • 2

Answers •1

what is the identity of the gas that is produced

We start with 153 grams of NH3, and 416 grams of O2. What is the limiting reactant?

What is the limiting reactant if we start with 158 mol C2H5OH, and 460 mol O2?

Im trying to figure out the weight of something from kg/meter and need to put it into lb/ft.

partial OXIDATION OF HYDROCARBONS IN NATURAL GAS

How does the carboxly group bond and why do they bond

Calculate the smallest whole number ration of moles of water to moles of anhydrous salt.

Simple carbohydrates consist of sugar

How many atoms of hydrogen is there in 2,24 litres of water gas

Assume that the air used to pressurize the chamber is 21 percent O2 by volume.

What is 3k-2=10 what does k =

A can of juice at 20°C is completely submerged in a closed, insulated container filled with water at 4°C, as shown in the diagram.

Write the following rate as a unit rate. On average in a recent year, it cost each passenger about $597 to travel 5970 miles internationally by plane.

how to find molar mass of an unknown compound

Chemistry size of elements

vapor pressure of solution 13.00 g of CaCl2 in 115.0 g of H2O at 70 ∘C, van't Hoff factor of 2.7? The vapor pressure of pure water at 70 ∘C is 233.7 mmHg.

Calculate the change in free energy for 4NH3 +7O2 yields 4NO2 +6H2O

How many degrees Celcius can 1 gram of water be heated by 0.26 Calories (kcal)

Why does a fire(with flames)produce smoke?

how to perform 1: 5 x 10^ 3 dilution ?

The half-life for the radioactive decay of calcium-47 is 4.5 d. If a sample has an activity of 4.0 Ci after 18 d , what was the initial activity of the sample?

Chemistry trend in ionization

Chemistry VIIIA group

Chemistry: What is the mass of the matter inside a container

why do we filter a solution, before distilling it?

Still looking for help? Get the right answer, fast.

OR

J.R. S.

IXL

Rosetta Stone

Education.com

TPT

Vocabulary.com

ABCya

SpanishDictionary.com

Inglés.com

Emmersion

what is the identity of the gas that is produced

We start with 153 grams of NH3, and 416 grams of O2. What is the limiting reactant?

What is the limiting reactant if we start with 158 mol C2H5OH, and 460 mol O2?

Im trying to figure out the weight of something from kg/meter and need to put it into lb/ft.

partial OXIDATION OF HYDROCARBONS IN NATURAL GAS

How does the carboxly group bond and why do they bond

Calculate the smallest whole number ration of moles of water to moles of anhydrous salt.

Simple carbohydrates consist of sugar

How many atoms of hydrogen is there in 2,24 litres of water gas

Assume that the air used to pressurize the chamber is 21 percent O2 by volume.

What is 3k-2=10 what does k =

A can of juice at 20°C is completely submerged in a closed, insulated container filled with water at 4°C, as shown in the diagram.

Write the following rate as a unit rate. On average in a recent​ year, it cost each passenger about ​$597 to travel 5970 miles internationally by plane.

how to find molar mass of an unknown compound

Chemistry size of elements

vapor pressure of solution 13.00 g of CaCl2 in 115.0 g of H2O at 70 ∘C, van't Hoff factor of 2.7? The vapor pressure of pure water at 70 ∘C is 233.7 mmHg.

Calculate the change in free energy for 4NH3 +7O2 yields 4NO2 +6H2O

How many degrees Celcius can 1 gram of water be heated by 0.26 Calories (kcal)

Why does a fire(with flames)produce smoke?

how to perform 1: 5 x 10^ 3 dilution ?

The half-life for the radioactive decay of calcium-47 is 4.5 d. If a sample has an activity of 4.0 Ci after 18 d , what was the initial activity of the sample?

Chemistry trend in ionization

Chemistry VIIIA group

Chemistry: What is the mass of the matter inside a container

why do we filter a solution, before distilling it?

Still looking for help? Get the right answer, fast.

OR

J.R. S.

Write the following rate as a unit rate. On average in a recent year, it cost each passenger about $597 to travel 5970 miles internationally by plane.