Find an Online Tutor Now

10 Answered Questions for the topic Nomenclature

Nomenclature Organic Chemistry

07/11/19

What is the IUPAC nomenclature of alkane with large numbers of C atoms (more than 200)?

What is the IUPAC nomenclature for alkanes with large numbers of $\\ce{C}$ atoms (more than 200)? For example, what is the IUPAC accepted name for $\\ce{C_{205}H_{412}}$?
Nomenclature Biochemistry Terminology

07/10/19

What is the difference between a protein and a factor?

In terms of nomenclature/semantics, why are some proteins named proteins, and some named factors?I've been revising on eukaryotic DNA, and I've come across some proteins that seem to serve roughly... more

07/05/19

Can you have a meta stereocenter?

Imagine a compound such as 1,3-dibromo-1,2,3-trichloropropane. Since the first and third carbons are attached to four different groups, they are both chiral centers. Assuming that both of these... more

06/27/19

Correctness of writing H3C as opposed to CH3 in a carbon chain?

I have been studying alkanes, alkenes & alkynes for a while, and I see in the examples that all the basic structural formulas start with $\\ce{CH3}$, then $\\ce{CH2}$, and the last carbon atom... more
Nomenclature Botany Taxonomy

06/14/19

Hominidae is to hominid as Poaceae is to what?

I considered asking this on English. SE, but decided against it, since it strictly applies to biological nomenclature, which not many of them will know about - particularly that of plants. So, in... more

04/16/19

What is the difference between polyethene and polyethane?

Nomenclature Zoology Ecology

03/27/19

What is called the "area size that an animal usually lives in"?

What is called the "area size that an animal usually lives in" or "needs for a normal life"? Is there any specific term?
Nomenclature Organic Chemistry Isomers

03/18/19

What determines whether a step in a reaction is reversible?

What makes a step in a reaction not reversible? I'm learning all these mechanisms and having to memorize which steps are reversible. Is there a way to figure out whether it's reversible or not?

03/13/19

What is the difference between hydroxyl, hydroxide and hydroxy?

Is there any difference between hydroxide, hydroxyl, and hydroxy used in chemistry or are they all the same?
Nomenclature

08/11/17

Iupac of COOH-CH2-C(COOH)(OH)-CH2-COOH

Answer in the book was 3-carboxy-3-hydroxypentanedicarboxylic acid

Still looking for help? Get the right answer, fast.

Ask a question for free

Get a free answer to a quick problem.
Most questions answered within 4 hours.

OR

Find an Online Tutor Now

Choose an expert and meet online. No packages or subscriptions, pay only for the time you need.